3407-94-1 Usage
Uses
Used in Pharmaceutical Industry:
2,6-Acridinediamine(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds, contributing to the development of new drugs and therapeutic agents. Its potential as a DNA intercalator makes it a candidate for applications in cancer treatment and other genetic-related therapies.
Used in Materials Science:
In the materials science field, 2,6-Acridinediamine(9CI) is used as a building block for the creation of novel materials with unique properties. Its chemical structure allows for the engineering of materials with potential applications in areas such as electronics, optics, and advanced materials research.
Used in Antimicrobial Applications:
2,6-Acridinediamine(9CI) is used as an antimicrobial agent, leveraging its ability to interfere with microbial processes and inhibit the growth of bacteria, fungi, and other pathogens. This makes it a valuable component in the development of new antimicrobial products for medical, industrial, and consumer applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3407-94-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,0 and 7 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3407-94:
(6*3)+(5*4)+(4*0)+(3*7)+(2*9)+(1*4)=81
81 % 10 = 1
So 3407-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N3/c14-10-3-4-12-9(6-10)5-8-1-2-11(15)7-13(8)16-12/h1-7H,14-15H2
