34545-88-5 Usage
Description
7-METHYL-4,4A-5,6-TETRAHYDRO-2(3H)NAPHTHALENONE is a chemical compound characterized by its sweet coumarin-like odor. It is a derivative of the naphthalenone family, which is known for its diverse range of applications in various industries.
Uses
Used in Fragrance Industry:
7-METHYL-4,4A-5,6-TETRAHYDRO-2(3H)NAPHTHALENONE is used as a fragrance ingredient for its sweet coumarin-like odor. Its unique scent makes it a valuable addition to the creation of perfumes, colognes, and other scented products.
Used in Flavor Industry:
In the flavor industry, 7-METHYL-4,4A-5,6-TETRAHYDRO-2(3H)NAPHTHALENONE is used as an additive to enhance the taste and aroma of various food and beverage products. Its sweet coumarin-like odor can contribute to the overall flavor profile of these products, making them more appealing to consumers.
Used in Pharmaceutical Industry:
7-METHYL-4,4A-5,6-TETRAHYDRO-2(3H)NAPHTHALENONE may also find applications in the pharmaceutical industry, where its chemical properties could be utilized for the development of new drugs or as a component in existing medications.
Used in Chemical Research:
As a chemical compound, 7-METHYL-4,4A-5,6-TETRAHYDRO-2(3H)NAPHTHALENONE can be used in research and development for understanding its properties, reactivity, and potential applications in various chemical processes and reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 34545-88-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,5,4 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 34545-88:
(7*3)+(6*4)+(5*5)+(4*4)+(3*5)+(2*8)+(1*8)=125
125 % 10 = 5
So 34545-88-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H14O/c1-8-2-3-9-4-5-11(12)7-10(9)6-8/h6-7,9H,2-5H2,1H3
