348098-29-3 Usage
Description
2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID is a chemical compound with the molecular formula C6H7BN2OS. It is a boronic acid derivative of the pyrimidine compound, containing a boron atom attached to the pyrimidine ring. 2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID is recognized for its role as a building block in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its boronic acid moiety allows it to be used in Suzuki coupling reactions to form carbon-carbon bonds, making it a versatile tool in the synthesis of complex organic molecules. Additionally, 2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID is known for its potential as a ligand in organometallic chemistry and as a substrate for enzyme-catalyzed reactions.
Uses
Used in Organic Synthesis:
2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID is used as a building block for the synthesis of complex organic molecules, particularly in the pharmaceutical and agrochemical industries. Its boronic acid functionality enables the formation of carbon-carbon bonds through Suzuki coupling reactions, facilitating the creation of a wide range of organic compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID is utilized as a key intermediate in the development of new pharmaceuticals. Its unique structure and reactivity allow for the design and synthesis of novel drug candidates with potential therapeutic applications.
Used in Organometallic Chemistry:
2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID also serves as a ligand in organometallic chemistry, where it can be used to modify the properties of metal complexes and enhance their performance in various catalytic and coordination processes.
Used in Enzyme-Catalyzed Reactions:
Furthermore, 2-(METHYLTHIO)PYRIMIDINE-5-BORONIC ACID is recognized as a substrate for enzyme-catalyzed reactions, which can be employed to selectively modify its structure and generate new bioactive compounds with potential applications in medicine and other fields.
Check Digit Verification of cas no
The CAS Registry Mumber 348098-29-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,4,8,0,9 and 8 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 348098-29:
(8*3)+(7*4)+(6*8)+(5*0)+(4*9)+(3*8)+(2*2)+(1*9)=173
173 % 10 = 3
So 348098-29-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H7BN2O2S/c1-11-5-7-2-4(3-8-5)6(9)10/h2-3,9-10H,1H3
348098-29-3Relevant articles and documents
NOVEL COMPOUNDS AS GPR119 AGONISTS
-
Paragraph 0499-0501, (2017/10/26)
The present invention relates to novel compounds of formula (I) as GPR119 agonist, composition compositions containing such compounds and method of preparation thereof.