35112-05-1 Usage
Uses
Used in Pharmaceutical Research and Development:
4-CHLORO-2-FLUORO-5-NITROBENZOIC ACID is used as a building block in the synthesis of various pharmaceutical compounds. Its unique structure and functional groups make it a valuable component in the development of new drugs with specific therapeutic properties.
Used in Antimicrobial Applications:
4-CHLORO-2-FLUORO-5-NITROBENZOIC ACID has been studied for its potential antimicrobial properties. Its ability to inhibit the growth of certain microorganisms makes it a candidate for use in the development of new antimicrobial agents.
Used in Anti-inflammatory Applications:
4-CHLORO-2-FLUORO-5-NITROBENZOIC ACID has also been investigated for its potential anti-inflammatory properties. Its ability to reduce inflammation could be utilized in the development of new treatments for inflammatory conditions.
Used in Dyes and Pigments Production:
Due to its aromatic structure, 4-CHLORO-2-FLUORO-5-NITROBENZOIC ACID may have applications in the production of dyes and pigments. Its unique color properties could be harnessed to create new dyes and pigments for various industries, such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 35112-05-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,1,1 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 35112-05:
(7*3)+(6*5)+(5*1)+(4*1)+(3*2)+(2*0)+(1*5)=71
71 % 10 = 1
So 35112-05-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClFNO4/c8-4-2-5(9)3(7(11)12)1-6(4)10(13)14/h1-2H,(H,11,12)/p-1
