353-05-9 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Fluoro-1-propanol acetate is utilized as a key intermediate in the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique fluorinated structure allows for the creation of molecules with distinct properties, enhancing the efficacy and selectivity of resulting pharmaceutical compounds.
Used in Organic Compound Synthesis:
In the field of organic chemistry, 3-fluoro-1-propanol acetate serves as a versatile building block for the synthesis of a wide range of organic compounds. Its reactivity and compatibility with various chemical reactions enable the production of specialty chemicals, agrochemicals, and other industrial products.
Used in Material Science:
3-Fluoro-1-propanol acetate is employed in material science as a component in the development of novel materials with improved properties. Its incorporation into polymers and other materials can enhance characteristics such as thermal stability, chemical resistance, and mechanical strength, making it valuable for applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 353-05-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,5 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 353-05:
(5*3)+(4*5)+(3*3)+(2*0)+(1*5)=49
49 % 10 = 9
So 353-05-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H9FO2/c1-5(7)8-4-2-3-6/h2-4H2,1H3
