35354-86-0 Usage
Uses
Used in Pharmaceutical Industry:
N-(Acetoacetyl)anthranilic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a building block for the development of new drugs, contributing to the advancement of medical treatments.
Used in Dye Industry:
In the dye industry, N-(Acetoacetyl)anthranilic acid is utilized as an intermediate for the production of different types of dyes. Its chemical properties make it suitable for creating a wide range of colors, enhancing the variety of dyes available for various applications.
Used in Chemical Research:
N-(Acetoacetyl)anthranilic acid is also employed in chemical research as a model compound for studying the properties and reactions of anthranilic acid derivatives. This helps in understanding the behavior of similar compounds and can lead to the discovery of new chemical reactions and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 35354-86-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,3,5 and 4 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 35354-86:
(7*3)+(6*5)+(5*3)+(4*5)+(3*4)+(2*8)+(1*6)=120
120 % 10 = 0
So 35354-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO4/c1-7(13)6-10(14)12-9-5-3-2-4-8(9)11(15)16/h2-5H,6H2,1H3,(H,12,14)(H,15,16)
