3561-56-6 Usage
General Description
Z-ASN-ONB, also known as Z-Asn-ONB, is a chemical compound commonly used in the field of organic synthesis and bioconjugation. It is a derivative of the amino acid asparagine and contains a benzyl group and a nitrobenzyl group attached to the nitrogen atom. Z-ASN-ONB is often employed as a building block in the synthesis of peptides and proteins, particularly in the modification of amino acids for various biotechnological and pharmaceutical applications. Its reactive functional groups allow for specific and selective labeling of proteins and peptides, making it a valuable tool in chemical biology research and drug development. Additionally, Z-ASN-ONB has potential applications in the development of targeted drug delivery systems and diagnostics.
Check Digit Verification of cas no
The CAS Registry Mumber 3561-56-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,6 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 3561-56:
(6*3)+(5*5)+(4*6)+(3*1)+(2*5)+(1*6)=86
86 % 10 = 6
So 3561-56-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H19N3O7/c20-17(23)10-16(21-19(25)29-12-13-4-2-1-3-5-13)18(24)28-11-14-6-8-15(9-7-14)22(26)27/h1-9,16H,10-12H2,(H2,20,23)(H,21,25)