35674-20-5 Usage
Description
3,4-Diiodobenzoic acid is a chemical compound derived from benzoic acid, featuring a benzene ring with a carboxylic acid group and two iodine atoms at the 3,4-positions. It is known for its reactivity and ability to participate in various chemical reactions, such as esterification, amidation, and halogenation. With a molecular weight of 397.89 g/mol and a melting point of 212-214°C, this compound serves as a versatile intermediate in the synthesis of pharmaceuticals and organic compounds.
Uses
Used in Pharmaceutical Industry:
3,4-Diiodobenzoic acid is used as a synthetic intermediate for the development of various pharmaceuticals. Its unique structure and reactivity allow for the creation of complex molecules with potential therapeutic applications.
Used in Organic Chemistry:
In the field of organic chemistry, 3,4-Diiodobenzoic acid is utilized as a building block for synthesizing more complex organic compounds. Its ability to undergo multiple types of chemical reactions makes it a valuable component in the creation of new molecules with specific properties.
Used in Liquid Crystal Development:
3,4-Diiodobenzoic acid is employed in the development of liquid crystals due to its molecular structure and properties. It contributes to the formation of liquid crystal materials with unique characteristics, which have applications in various display technologies.
Used as a Precursor in Dye and Pigment Production:
3,4-Diiodobenzoic acid also serves as a precursor for the production of dyes and pigments. Its chemical properties enable the synthesis of colorants with specific hues and stability, which are used in various industries such as textiles, paints, and plastics.
Check Digit Verification of cas no
The CAS Registry Mumber 35674-20-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,6,7 and 4 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 35674-20:
(7*3)+(6*5)+(5*6)+(4*7)+(3*4)+(2*2)+(1*0)=125
125 % 10 = 5
So 35674-20-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H4I2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11)
35674-20-5Relevant articles and documents
Synthesis of highly efficient pH-sensitive DNA cleaving aminomethyl N-substituted cyclic enediyne and its L-lysine conjugate
Hatial, Ishita,Addy, Partha S.,Ghosh, Ananta K.,Basak, Amit
supporting information, p. 854 - 857 (2013/03/13)
Two 10-membered benzo-fused N-substituted cyclic enediynes, one an amino methyl and the other, a C-lysine conjugated derivative 2 and 3, respectively were synthesized (as a 1.2:1 mixture of regioisomers) and their DNA-cleavage efficiency studied. Both the compounds showed much better DNA-cleavage profile than that of the parent unsubstituted enediyne 1. The lysine conjugate 3 showed an efficient pH dependent cleavage to the extent of ~50% of linear DNA formation under ambient conditions.
Easy, inexpensive and effective oxidative iodination of deactivated arenes in sulfuric acid
Kraszkiewicz, Lukasz,Sosnowski, MacIej,Skulski, Lech
, p. 9113 - 9119 (2007/10/03)
Two 'model' deactivated arenes, benzoic acid and nitrobenzene, were effectively monoiodinated within 1 h at 25-30 °C, with strongly electrophilic I+ reagents, prior prepared from diiodine and various oxidants (CrO3, KMnO4, active MnO2, HIO 3, NaIO3, or NaIO4) in 90% (v/v) concd sulfuric acid (ca. 75 mol% H2SO4). Next, an I2/ NaIO3/90% (v/v) concd H2SO4 exemplary system was used to effectively mono- or diiodinate a number of deactivated arenes. All former papers dealing with the direct iodination of deactivated arenes are briefly reviewed.