358672-65-8 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-6-chloropyridin-2-amine is used as a building block for the synthesis of pharmaceuticals, contributing to the development of new drugs with improved therapeutic properties. Its unique structure allows for the creation of diverse chemical entities with potential medicinal applications.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Bromo-6-chloropyridin-2-amine is employed as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Organic Chemistry Research:
5-Bromo-6-chloropyridin-2-amine serves as a valuable reagent in organic chemistry research, facilitating the exploration of novel chemical reactions and the synthesis of complex organic molecules. Its presence in various reaction schemes can lead to the discovery of new compounds with unique properties and potential applications.
Used in Medicinal Chemistry Research:
As a reagent in medicinal chemistry research, 5-Bromo-6-chloropyridin-2-amine is instrumental in the design and synthesis of bioactive molecules with therapeutic potential. Its versatile structure enables the development of new drug candidates that can target specific biological pathways and address unmet medical needs.
Used in Drug Discovery and Development:
5-Bromo-6-chloropyridin-2-amine plays a significant role as an intermediate in the production of various bioactive molecules, making it an essential component in drug discovery and development processes. Its presence in the synthesis of potential drug candidates can contribute to the advancement of novel therapeutic agents with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 358672-65-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,8,6,7 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 358672-65:
(8*3)+(7*5)+(6*8)+(5*6)+(4*7)+(3*2)+(2*6)+(1*5)=188
188 % 10 = 8
So 358672-65-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BrClN2/c6-3-1-2-4(8)9-5(3)7/h1-2H,(H2,8,9)
