36038-57-0 Usage
Uses
Used in Organic Synthesis:
2,3-dibromo-1,4-dichlorobut-2-ene is used as a reagent in organic synthesis for its unique reactivity, enabling the formation of various complex organic molecules.
Used in Chemical Research:
2,3-dibromo-1,4-dichlorobut-2-ene is utilized in chemical research to study its reactivity and properties, contributing to the understanding of halogenated compounds and their behavior in chemical reactions.
Used in Specialty Chemicals Production:
2,3-dibromo-1,4-dichlorobut-2-ene is used as an intermediate in the production of specialty chemicals, where its unique properties are leveraged to create high-value products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3-dibromo-1,4-dichlorobut-2-ene is used as a building block for the synthesis of certain pharmaceutical compounds, taking advantage of its reactivity to form specific molecular structures.
Used in Agrochemicals:
2,3-dibromo-1,4-dichlorobut-2-ene has potential applications in agrochemicals, where its unique properties may be utilized in the development of new pesticides or other agricultural chemicals.
However, due to its reactivity and toxicity, 2,3-dibromo-1,4-dichlorobut-2-ene is considered a hazardous compound that requires careful handling and disposal to ensure safety and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 36038-57-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,0,3 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 36038-57:
(7*3)+(6*6)+(5*0)+(4*3)+(3*8)+(2*5)+(1*7)=110
110 % 10 = 0
So 36038-57-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H4Br2Cl2/c5-3(1-7)4(6)2-8/h1-2H2/b4-3+
