361390-39-8 Usage
General Description
4-(2-Quinoxalinylamino)benzoic acid ethyl ester is a chemical compound that is commonly used in pharmaceutical research and development. It is an ethyl ester derivative of 4-(2-Quinoxalinylamino)benzoic acid, which is known for its potential as a therapeutic agent in the treatment of various diseases. This chemical has been studied for its potential anti-inflammatory, antioxidant, and antitumor activities. Its unique structure and properties make it a promising candidate for further drug development and medicinal applications. Additionally, it has been investigated for its potential as a fluorescent probe for the detection of various metal ions. Overall, 4-(2-Quinoxalinylamino)benzoic acid ethyl ester is a versatile and important chemical compound with potential applications in various fields, particularly in the pharmaceutical and biomedical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 361390-39-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,1,3,9 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 361390-39:
(8*3)+(7*6)+(6*1)+(5*3)+(4*9)+(3*0)+(2*3)+(1*9)=138
138 % 10 = 8
So 361390-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H15N3O2/c1-2-22-17(21)12-7-9-13(10-8-12)19-16-11-18-14-5-3-4-6-15(14)20-16/h3-11H,2H2,1H3,(H,19,20)