36151-45-8 Usage
Description
4-(2-Oxo-1-pyrrolidinyl)benzaldehyde is a chemical compound classified under the organic phenylpyrrolidines, with the molecular formula C12H11NO2. Its systematic name, as defined by the IUPAC, is 4-Formyl-1-pyrrolidin-2-yl-benzene. 4-(2-Oxo-1-pyrrolidinyl)benzaldehyde is characterized by its high solubility in water and a slightly yellowish or colorless appearance. It is primarily utilized as a reagent in the synthesis of other complex chemical compounds for research or testing purposes. Due to its potential to cause irritation to the skin, eyes, and respiratory tract, safety precautions are crucial when handling this chemical.
Uses
Used in Chemical Research and Testing:
4-(2-Oxo-1-pyrrolidinyl)benzaldehyde is used as a reagent for the synthesis of complex chemical compounds, facilitating research and testing in various scientific fields. Its high solubility in water and unique chemical properties make it a valuable component in the development of new substances and materials.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-(2-Oxo-1-pyrrolidinyl)benzaldehyde is used as an intermediate in the synthesis of various pharmaceutical compounds. Its ability to form stable bonds with other molecules allows for the creation of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
4-(2-Oxo-1-pyrrolidinyl)benzaldehyde is used as a key component in the synthesis of a wide range of chemical products, including dyes, pigments, and other specialty chemicals. Its versatility in forming stable chemical bonds contributes to the development of innovative and high-performance materials.
Used in Material Science:
In the field of material science, 4-(2-Oxo-1-pyrrolidinyl)benzaldehyde is employed as a precursor in the development of advanced materials with unique properties. Its ability to participate in various chemical reactions enables the creation of materials with improved performance characteristics, such as enhanced stability, durability, or specific functional properties.
Check Digit Verification of cas no
The CAS Registry Mumber 36151-45-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,1,5 and 1 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 36151-45:
(7*3)+(6*6)+(5*1)+(4*5)+(3*1)+(2*4)+(1*5)=98
98 % 10 = 8
So 36151-45-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO2/c13-8-9-3-5-10(6-4-9)12-7-1-2-11(12)14/h3-6,8H,1-2,7H2
36151-45-8Relevant articles and documents
N-SUBSTITUTED-3,4-(FUSED 5-RING)-5-PHENYL-PYRROLIDINE-2-ONE COMPOUNDS AS INHIBITORS OF ISOQC AND/OR QC ENZYME
-
Page/Page column 214-215, (2021/02/12)
The present invention pertains generally to the field of therapeutic compounds. More specifically the present invention pertains to certain N-substituted-3,4-(fused 5-ring)-5-phenyl-pyrrolidin-2-one compounds (also referred to herein as "FRPPO compounds"), that, inter alia, inhibit glutaminyl-peptide cyclotransferase-like (isoQC) enzyme and/or glutaminyl-peptide cyclotransferase (QC) enzyme (e.g., inhibit or reduce or block the activity or function of isoQC and/or QC enzyme). The present invention also pertains to pharmaceutical compositions comprising such compounds, and the use of such compounds and compositions, both in vitro and in vivo, to inhibit isoQC and/or QC enzyme; to treat disorders that are ameliorated by the inhibition of isoQC and/or QC enzyme; to treat cancer, atherosclerosis, fibrotic diseases, infectious diseases, Alzheimer's disease, etc.
