36585-12-3 Usage
Chemical compound
2-[(2-hydroxyethyl)thio]-N-methylpropionamide is a chemical compound that is classified as a propanamide derivative.
Functional groups
The compound contains a thio functional group and a hydroxyethyl moiety, which give it unique properties.
Potential use as a pharmaceutical agent
Due to its unique properties, 2-[(2-hydroxyethyl)thio]-N-methylpropionamide has the potential to be used as a drug or pharmaceutical agent.
Use in the pharmaceutical and healthcare industries
The compound is commonly used in the pharmaceutical and healthcare industries as an active ingredient in various medications and therapeutic treatments.
Research and development
2-[(2-hydroxyethyl)thio]-N-methylpropionamide is also used in research and development due to its ability to interact with biological systems and potentially impact various physiological processes.
Antimicrobial and antibacterial properties
The compound may possess antimicrobial or antibacterial properties, making it a sought-after compound for use in medical and healthcare applications.
Check Digit Verification of cas no
The CAS Registry Mumber 36585-12-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,8 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 36585-12:
(7*3)+(6*6)+(5*5)+(4*8)+(3*5)+(2*1)+(1*2)=133
133 % 10 = 3
So 36585-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2S/c1-5(6(9)7-2)10-4-3-8/h5,8H,3-4H2,1-2H3,(H,7,9)
