36778-78-6 Usage
Heterocyclic compound
Oxazole and oxazoline rings The compound contains both oxazole (five-membered ring with one nitrogen atom) and oxazoline (five-membered ring with one nitrogen and one oxygen atom) heterocyclic rings.
Phenyl groups
2 The compound has two phenyl groups (a six-membered carbon ring with alternating single and double bonds) attached to the oxazole ring.
Hydroxymethyl group
1 A hydroxymethyl group (a methyl group with a hydroxyl group attached) is present in the compound, attached to the oxazole ring.
Medicinal chemistry and pharmaceutical research
Potential drug candidate or building block The compound is often used in these fields as a potential drug candidate or as a building block for the synthesis of other complex molecules.
Further investigation and characterization
Specific properties and potential applications The compound's specific properties and potential applications would require additional research and characterization to be fully understood.
Check Digit Verification of cas no
The CAS Registry Mumber 36778-78-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,7,7 and 8 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 36778-78:
(7*3)+(6*6)+(5*7)+(4*7)+(3*8)+(2*7)+(1*8)=166
166 % 10 = 6
So 36778-78-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H19NO3/c20-11-18-12-21-16(14-7-3-1-4-8-14)19(18)17(22-13-18)15-9-5-2-6-10-15/h1-10,16-17,20H,11-13H2