36855-78-4 Usage
Uses
Used in Pharmaceutical Industry:
4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide is used as a key intermediate in the synthesis of various pharmaceuticals due to its versatile reactivity and potential biological activities. Its unique structure allows for the development of new drugs with diverse therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical industry, 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its reactivity and potential biological activities make it a valuable component in the development of effective and environmentally friendly agrochemicals.
Used as an Anticancer Agent:
4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide has been studied for its potential as an anticancer agent. Its unique structure and reactivity may contribute to the development of new cancer treatments, offering alternative therapeutic options for patients.
Used as an Anti-inflammatory Agent:
4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide has also been investigated for its potential as an anti-inflammatory agent. Its ability to modulate inflammatory pathways could lead to the development of new treatments for various inflammatory conditions, improving patient outcomes.
Used as an Antifungal Agent:
4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide has shown potential as an antifungal agent, making it a promising candidate for the development of new antifungal drugs. Its unique structure and reactivity may contribute to the creation of effective treatments for fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 36855-78-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,8,5 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 36855-78:
(7*3)+(6*6)+(5*8)+(4*5)+(3*5)+(2*7)+(1*8)=154
154 % 10 = 4
So 36855-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N4OS/c1-6-13-14-10(16-6)12-9(15)7-2-4-8(11)5-3-7/h2-5H,11H2,1H3,(H,12,14,15)
36855-78-4Relevant academic research and scientific papers
MODULATORS OF IMMUNOINHIBITORY RECEPTOR PD-1, AND METHODS OF USE THEREOF
-
, (2011/07/30)
Disclosed are an assay to identify modulators of the PD-1 :PD-L pathway and PD-1 :PD-L pathway modulators, e.g., compounds and pharmaceutical compositions thereof. Methods for treating diseases influenced by modulation of the PD-1 :PD-L pathway such as, for example, autoimmune diseases, inflammatory disorders, allergies, transplant rejection, cancer, immune deficiency, and other immune system-related disorders, are also disclosed.
