37136-95-1 Usage
Uses
Used in Pharmaceutical Manufacturing:
1-(2-bromoethoxy)-2,3-dimethylbenzene is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of a wide range of medicinal agents, making it a valuable component in drug development.
Used in Organic Synthesis:
As a reagent, 1-(2-bromoethoxy)-2,3-dimethylbenzene plays a crucial role in organic synthesis, facilitating the production of different organic compounds. Its functional groups enable it to participate in various chemical reactions, contributing to the synthesis of a diverse array of molecules.
Used as a Solvent:
1-(2-bromoethoxy)-2,3-dimethylbenzene is also employed as a solvent in certain chemical processes. Its ability to dissolve a variety of substances makes it a useful component in various industrial applications.
Used in Chemical Production:
1-(2-bromoethoxy)-2,3-dimethylbenzene serves as an intermediate in the production of other chemicals, highlighting its importance in the chemical industry. Its versatility and reactivity contribute to the synthesis of a broad spectrum of chemical products.
Safety Precautions:
It is essential to handle and use 1-(2-bromoethoxy)-2,3-dimethylbenzene with care, as it may pose health risks if ingested, inhaled, or absorbed through the skin. Additionally, it may act as a skin and eye irritant, necessitating proper safety measures during its use in laboratories and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 37136-95-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,1,3 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 37136-95:
(7*3)+(6*7)+(5*1)+(4*3)+(3*6)+(2*9)+(1*5)=121
121 % 10 = 1
So 37136-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BrO/c1-8-4-3-5-10(9(8)2)12-7-6-11/h3-5H,6-7H2,1-2H3
37136-95-1Relevant academic research and scientific papers
DERIVATIVES OF AMINOALKANOLS, METHOD OF OBTAINING OF AMINOALKANOLS AND THEIR USE
-
Page/Page column 7, (2011/02/25)
The subject of the invention is a group of new derivatives of aminoalkaπols, more specifically [(phenoxy)alkyl]aminoalkanols and [(phenoxy)acyl)aminoalkanols, their method of obtaining and their use for production of a medicine which is used in the prophylaxis, prevention and/or treatment of diseases or symptoms having neurological background and for production of a medicine with anticonvulsant activity, which is used in seizures of various origin, also in the limbic system, in myoclonic or sound-induced seizures, in psychomotor epilepsy, as well as in relieving neuropathic or inflammatory pain.
