3780-41-4 Usage
Uses
Used in Pharmaceutical Production:
3-Methyl-pyrrole-2,4-dicarboxylic acid is used as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic effects.
Used in Organic Synthesis:
As a pyrrole derivative, 3-Methyl-pyrrole-2,4-dicarboxylic acid is utilized as a key component in the organic synthesis of complex molecules, contributing to the creation of novel chemical entities with potential applications in various fields.
Used in Drug Development:
3-Methyl-pyrrole-2,4-dicarboxylic acid is employed as a building block in the development of new drugs. Its presence in molecular structures can enhance the pharmacological properties of these drugs, leading to improved therapeutic outcomes.
Used in Materials Science:
3-Methyl-pyrrole-2,4-dicarboxylic acid is used in the design and synthesis of new materials with unique properties. Its incorporation into these materials can result in enhanced performance characteristics, such as improved stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 3780-41-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,8 and 0 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3780-41:
(6*3)+(5*7)+(4*8)+(3*0)+(2*4)+(1*1)=94
94 % 10 = 4
So 3780-41-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO4/c1-3-4(6(9)10)2-8-5(3)7(11)12/h2,8H,1H3,(H,9,10)(H,11,12)
3780-41-4Relevant academic research and scientific papers
Synthesis of coumermycin A1
Olson, Steven H.,Slossberg, Llnon H.
, p. 61 - 63 (2007/10/03)
A concise synthesis of the antibiotic coumermycin A1, a natural product isolated from streptomyces, was achieved. In a key step, a selectively protected noviose sugar was prepared from novobiocin through a transglycosylation reaction with aceto
