38061-69-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) is used as a pharmaceutical intermediate for the synthesis of various drugs and active pharmaceutical ingredients. Its unique chemical structure, including the isoxazole ring and carboxylic acid group, allows for the development of novel therapeutic agents with specific biological activities.
Used in Agrochemical Industry:
3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI)'s reactivity and functional groups enable the creation of new molecules with targeted pest control properties, contributing to more effective and environmentally friendly agricultural practices.
Used in Material Science:
3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) is utilized in the development of advanced materials, such as polymers and coatings, due to its reactive nature and the presence of the ethyl ester group. 3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) can be incorporated into the synthesis of new polymers with specific properties, such as improved thermal stability, mechanical strength, or chemical resistance, for use in various industries.
Used in Research and Development:
3-Isoxazolecarboxylicacid,4-methyl-,ethylester(9CI) serves as a valuable research tool in the study of chemical reactions and mechanisms involving isoxazole-containing compounds. Its unique structure allows researchers to explore new synthetic pathways and investigate the compound's reactivity, stability, and potential applications in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 38061-69-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,0,6 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 38061-69:
(7*3)+(6*8)+(5*0)+(4*6)+(3*1)+(2*6)+(1*9)=117
117 % 10 = 7
So 38061-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO3/c1-3-10-7(9)6-5(2)4-11-8-6/h4H,3H2,1-2H3
38061-69-7Relevant academic research and scientific papers
Substituted 1,2,4-triazolo[3,4-a]phthalazine derivatives as GABA alpha 5 ligands
-
, (2008/06/13)
Substituted 1,2,4-Triazolo[3,4-A]phthalazine derivatives are GABA Alpha 5 ligands and are represented by the formula
Phytotoxic 2-alkyl-5-(heterocyclic)-pyrrole-3,4-dicarboxylates
-
, (2008/06/13)
Phytotoxic 2-methyl-5-(heterocyclic)-pyrrole-3,4-dicarboxylates.
