38062-72-5 Usage
General Description
H-LEU-HIS-OH is a synthetic compound consisting of amino acids leucine and histidine linked by a peptide bond and terminated with a hydroxyl group. Leucine is a hydrophobic amino acid that plays a role in protein synthesis and muscle growth, while histidine is a positively charged amino acid involved in buffering and enzyme catalysis. H-LEU-HIS-OH may have applications in research, pharmaceuticals, and biotechnology due to its potential effects on protein structure and function. The specific properties and potential uses of H-LEU-HIS-OH make it an interesting and important chemical compound for further study and exploration.
Check Digit Verification of cas no
The CAS Registry Mumber 38062-72-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,0,6 and 2 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 38062-72:
(7*3)+(6*8)+(5*0)+(4*6)+(3*2)+(2*7)+(1*2)=115
115 % 10 = 5
So 38062-72-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H20N4O3/c1-7(2)3-9(13)11(17)16-10(12(18)19)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)
38062-72-5Relevant articles and documents
DPP4 INHIBITOR AND PHARMACEUTICAL APPLICATION THEREOF
-
Page/Page column 8-9, (2008/06/13)
The present invention provides a Dpp4 inhibitor which comprises a leucine derivative of the following formula (1) or a methionine derivative of the following formula (2): wherein each R1 and R3 represents a hydrogen atom (H) and an L-amino acid residue; R2 represents a hydroxyl group (OH), alkoxy group having 1 to 6 carbon atoms, amino group (NH2), alkylamino group having 1 to 6 carbon atoms, glycine residue, β-alanine residue, L-amino acid (except for proline, alanine and phenylalanine) residue or L-amino-acid amide (except for proline amide, alanine amide and phenylalanine amide) residue; and R4 represents a hydroxyl group (OH), alkoxy group having 1 to 6 carbon atoms, amino group (NH2), alkylamino group having 1 to 6 carbon atoms, glycine residue, β-alanine residue, L-amino acid (except for proline and alanine) residue or L-amino-acid amide (except for proline amide and alanine amide) residue. These derivatives also act as autophagy regulators.
