38185-54-5 Usage
Description
3-Pyridinecarboxylic acid, 6-bromo-5-chlorois a chemical compound with the molecular formula C6H3BrClNO2. It is a derivative of pyridinecarboxylic acid and contains bromine and chlorine as substituents. 3-Pyridinecarboxylic acid, 6-bromo-5-chlorois characterized by its unique structure and properties, making it a valuable component in various applications.
Uses
Used in Pharmaceutical Development:
3-Pyridinecarboxylic acid, 6-bromo-5-chlorois used as an intermediate in the synthesis of pharmaceuticals for its potential therapeutic properties. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways.
Used in Agrochemical Production:
In the agrochemical industry, 3-Pyridinecarboxylic acid, 6-bromo-5-chlorois utilized as a building block for the creation of pesticides and other crop protection agents. Its chemical properties contribute to the effectiveness of these products in managing pests and diseases in agriculture.
Used in Organic Synthesis:
3-Pyridinecarboxylic acid, 6-bromo-5-chloroserves as a versatile reactant in organic synthesis, enabling the production of a wide range of chemical compounds. Its reactivity and structural features make it a valuable precursor for various organic compounds.
Used in Medicinal Chemistry:
3-Pyridinecarboxylic acid, 6-bromo-5-chlorois also employed in medicinal chemistry for the design and synthesis of new pharmaceutical agents. Its unique structure allows researchers to explore its potential in treating various diseases and conditions, contributing to the advancement of medical treatments.
It is important to handle 3-Pyridinecarboxylic acid, 6-bromo-5-chlorowith care due to its potential hazards, and it should be used in a controlled environment to ensure safety.
Check Digit Verification of cas no
The CAS Registry Mumber 38185-54-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,8 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 38185-54:
(7*3)+(6*8)+(5*1)+(4*8)+(3*5)+(2*5)+(1*4)=135
135 % 10 = 5
So 38185-54-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrClNO2/c7-5-4(8)1-3(2-9-5)6(10)11/h1-2H,(H,10,11)