38186-87-7 Usage
General Description
5-fluoro-6-bromonicotinic acid is a chemical compound with the molecular formula C6H4BrFNO2. It is a derivative of nicotinic acid and contains a fluorine and bromine atom, making it a halogenated compound. This chemical is commonly used as a building block in organic synthesis and pharmaceutical research, with potential applications in the development of pharmaceutical drugs. It is also used as an intermediate in the production of agrochemicals and other specialty chemicals. Additionally, 5-fluoro-6-bromonicotinic acid has been studied for its anti-inflammatory properties and potential therapeutic applications. Overall, this compound has diverse uses and potential benefits in various fields of research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 38186-87-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,8 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 38186-87:
(7*3)+(6*8)+(5*1)+(4*8)+(3*6)+(2*8)+(1*7)=147
147 % 10 = 7
So 38186-87-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrFNO2/c7-5-4(8)1-3(2-9-5)6(10)11/h1-2H,(H,10,11)
