38186-89-9 Usage
General Description
2-Bromo-5-fluoro-3-pyridinecarboxylic acid is a chemical compound with the molecular formula C6H3BrFNO2. It is a derivative of pyridinecarboxylic acid, a known building block in the synthesis of pharmaceuticals and agrochemicals. The compound contains a fluorine atom and a bromine atom, making it useful for various chemical reactions and transformations. Its structure and functional groups make it potentially valuable for the development of new drug molecules and other biologically active compounds. Additionally, its halogen substituents may also impart unique reactivity and selectivity in chemical reactions. Therefore, 2-bromo-5-fluoro-3-pyridinecarboxylic acid is a versatile and valuable chemical building block with potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 38186-89-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,1,8 and 6 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 38186-89:
(7*3)+(6*8)+(5*1)+(4*8)+(3*6)+(2*8)+(1*9)=149
149 % 10 = 9
So 38186-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrFNO2/c7-5-4(6(10)11)1-3(8)2-9-5/h1-2H,(H,10,11)
