38293-63-9 Usage
General Description
4-OXOTETRAHYDROTHIOPHENE-2,3-DICARBOXYLIC ACID DIMETHYL ESTER is a chemical compound with the molecular formula C8H10O5S. It is a dimethyl ester derivative of 4-oxotetrahydrothiophene-2,3-dicarboxylic acid. 4-OXOTETRAHYDROTHIOPHENE-2,3-DICARBOXYLIC ACID DIMETHYL ESTER is commonly used in organic synthesis and pharmaceutical research due to its unique structure and reactivity. It is known for its potential role in the development of novel drugs and as a building block in the synthesis of various organic compounds. 4-OXOTETRAHYDROTHIOPHENE-2,3-DICARBOXYLIC ACID DIMETHYL ESTER has attracted interest in the scientific community for its diverse applications and potential in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 38293-63-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,2,9 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 38293-63:
(7*3)+(6*8)+(5*2)+(4*9)+(3*3)+(2*6)+(1*3)=139
139 % 10 = 9
So 38293-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O5S/c1-12-7(10)5-4(9)3-14-6(5)8(11)13-2/h5-6H,3H2,1-2H3