38293-63-9 Usage
Uses
Used in Organic Synthesis:
4-OXOTETRAHYDROTHIOPHENE-2,3-DICARBOXYLIC ACID DIMETHYL ESTER is used as a key intermediate in organic synthesis for its ability to contribute to the formation of complex organic molecules. Its unique structure allows it to participate in various chemical reactions, facilitating the creation of a wide range of organic compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-OXOTETRAHYDROTHIOPHENE-2,3-DICARBOXYLIC ACID DIMETHYL ESTER is utilized as a starting material or a building block in the development of new drugs. Its reactivity and structural properties make it a valuable component in medicinal chemistry, potentially leading to the discovery of innovative therapeutic agents.
Used in Drug Discovery and Development:
4-OXOTETRAHYDROTHIOPHENE-2,3-DICARBOXYLIC ACID DIMETHYL ESTER is employed in drug discovery and development processes to explore its potential as a precursor for new pharmaceutical entities. Its unique characteristics position it as a candidate for creating novel drug molecules with specific therapeutic targets and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 38293-63-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,2,9 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 38293-63:
(7*3)+(6*8)+(5*2)+(4*9)+(3*3)+(2*6)+(1*3)=139
139 % 10 = 9
So 38293-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O5S/c1-12-7(10)5-4(9)3-14-6(5)8(11)13-2/h5-6H,3H2,1-2H3