3833-07-6 Usage
Fluorinated ketone
A type of chemical compound 12-Fluoro-6-dodecanone belongs to the class of fluorinated ketones, which contain a fluorine atom and a carbonyl group (C=O) in their structure.
Flavoring agent
Common use in the food industry 12-Fluoro-6-dodecanone is widely used as a flavoring agent in the production of various food products, such as beverages and confectionery.
Pharmaceutical manufacturing
Application in drug production The compound is also used in the manufacturing of pharmaceuticals, contributing to the development of new medications.
Intermediate in organic synthesis
Use in synthesizing other organic compounds 12-Fluoro-6-dodecanone serves as an intermediate in organic synthesis, helping to create specialized organic compounds.
Fruity and sweet odor
Characteristic smell The compound has a fruity and sweet odor, which contributes to its use as a flavoring agent in various products.
Slightly pungent taste
Characteristic taste The taste of 12-Fluoro-6-dodecanone is slightly pungent, which may influence its application in food products.
Potential applications in new materials
Use in material development 12-Fluoro-6-dodecanone has potential applications in the development of new materials, making it a valuable compound in various industries.
Building block for specialized organic compounds
Role in creating complex molecules The compound can be used as a building block for the synthesis of specialized organic compounds, expanding its applications in various fields.
Caution and safety measures
Handling precautions Due to its chemical nature, 12-Fluoro-6-dodecanone should be handled with caution and appropriate safety measures to avoid potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 3833-07-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,8,3 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 3833-07:
(6*3)+(5*8)+(4*3)+(3*3)+(2*0)+(1*7)=86
86 % 10 = 6
So 3833-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H23FO/c1-2-3-6-9-12(14)10-7-4-5-8-11-13/h2-11H2,1H3
