39496-82-7

Usage

Uses

Used in Pharmaceutical Industry:
4-OXO-4-(4-PROPOXYPHENYL)BUTANOIC ACID is used as an active pharmaceutical ingredient for its anti-inflammatory and analgesic properties, providing relief from pain and reducing inflammation in various conditions.
Used in Research Applications:
In the research field, 4-OXO-4-(4-PROPOXYPHENYL)BUTANOIC ACID is utilized as a chemical probe to study its potential effects on biological systems and to explore its mechanism of action.
Used as an Intermediate in Organic Synthesis:
4-OXO-4-(4-PROPOXYPHENYL)BUTANOIC ACID is employed as a key intermediate in the synthesis of other organic compounds, contributing to the development of new chemical entities with potential applications in various industries.

InChI:InChI=1/C13H16O4/c1-2-9-17-11-5-3-10(4-6-11)12(14)7-8-13(15)16/h3-6H,2,7-9H2,1H3,(H,15,16)

Upstream product

• 108-30-5 succinic acid anhydride 
• 622-85-5 propoxybenzene 
• 66123-43-1 4-(4-hydroxyphenyl)-4-oxobutanoic acid ethyl ester 
• 106-94-5 propyl bromide 

Relevant academic research and scientific papers

Pyridazinones

Compounds of the general formula: SPC1 In which X represents a straight or branched chain alkyl or alkoxy group, a hydroxymethyl group, a cycloalkyl group, a cycloalkoxy group, an aryloxy group, a hydroxyl group, a fluorine atom, a chlorine atom, an amino or substituted amino group, a piperidino group, a morpholino group, a pyrrolidino group, a 1,2,3,6-tetrahydropyridino group, a 4-[3-azabicyclo(3,2,2)-nonyl] group, or a 4-(piperazin-1-yl) or 4-(4-substituted-piperazin-1-yl) group of the formula SPC2 In which R=H, lower alkyl or 1-5 carbon atoms, aryl, substituted aryl, aralkyl, cinnamyl, acyl, ethoxy-carbonyl, aroyl or substituted aroyl and n is an integer from 1 to 5 except that when n is 1 X is not an alkyl group of 1 to 3 carbon atoms or an alkoxy group of 1 or 2 carbon atoms or a chlorine atom in the 4'-position, or an amino or acylated amino group in positions 2', 3' or 4'; and when n = 2 the groups X cannot both be methyl or both be methoxy in the 2' and 5' positions, nor can X be a chlorine atom in both the 2' and 4' positions or the 3' and 4' positions, and when n = 3, X cannot all three be methoxy. These compounds have anti-hypertensive activity.