3958-13-2 Usage
Uses
Used in Organic Synthesis:
S-Cyanoethyl-L-cysteine is used as a synthetic building block for the creation of various organic compounds. Its unique structure allows for the development of complex molecules with potential applications in different industries, such as pharmaceuticals, agrochemicals, and materials science.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, S-Cyanoethyl-L-cysteine is used as an intermediate in the synthesis of drugs with potential therapeutic applications. Its reactivity and functional groups enable the development of novel drug candidates that can target specific biological pathways or interact with particular receptors.
Used in Agrochemical Industry:
S-Cyanoethyl-L-cysteine is also utilized in the agrochemical industry for the synthesis of bioactive compounds with pesticidal, herbicidal, or fungicidal properties. These compounds can be used to protect crops from pests and diseases, ensuring higher yields and better quality produce.
Used in Materials Science:
In the field of materials science, S-Cyanoethyl-L-cysteine can be employed in the development of novel materials with specific properties, such as improved mechanical strength, thermal stability, or chemical resistance. Its unique structure can contribute to the design of advanced materials for various applications, including electronics, aerospace, and automotive industries.
Check Digit Verification of cas no
The CAS Registry Mumber 3958-13-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,9,5 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3958-13:
(6*3)+(5*9)+(4*5)+(3*8)+(2*1)+(1*3)=112
112 % 10 = 2
So 3958-13-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2O2S/c7-2-1-3-11-4-5(8)6(9)10/h5H,1,3-4,8H2,(H,9,10)/t5-/m0/s1
