39638-84-1 Usage
Contains a purine derivative
The compound contains a purine derivative, which is a component of nucleic acids such as DNA and RNA.
Methylated form of guanine
The compound is a methylated form of the base guanine, which is one of the four nucleobases found in DNA and RNA.
Connected to a sugar molecule
The purine derivative is connected to a sugar molecule, making it a nucleoside.
Found in nature
The compound is commonly found in nature as a building block of genetic material.
Involved in cellular processes
The compound is involved in various cellular processes, including the storage and transfer of genetic information.
Unique molecular structure
The presence of the hydroxymethyl group and methoxy group gives the compound a unique molecular structure.
Influences biochemical and pharmacological properties
The unique molecular structure of the compound can potentially influence its biochemical and pharmacological properties.
Crucial role at the molecular level
The compound plays a crucial role in the functioning of living organisms at the molecular level.
Check Digit Verification of cas no
The CAS Registry Mumber 39638-84-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,6,3 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 39638-84:
(7*3)+(6*9)+(5*6)+(4*3)+(3*8)+(2*8)+(1*4)=161
161 % 10 = 1
So 39638-84-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N4O5/c1-19-11-12-2-5-9(14-11)15(4-13-5)10-8(18)7(17)6(3-16)20-10/h2,4,6-8,10,16-18H,3H2,1H3
