40358-68-7 Usage
Uses
Used in Pharmaceutical Industry:
Phospholane, 2,5-dimethyl-1-phenylis used as an intermediate in the production of various pharmaceuticals for its ability to contribute to the development of new drugs and enhance the properties of existing ones.
Used in Agrochemical Industry:
In the agrochemical sector, Phospholane, 2,5-dimethyl-1-phenylserves as an intermediate, playing a crucial role in the synthesis of agrochemicals that are designed to improve crop protection and yield.
Used in Organic Synthesis:
Phospholane, 2,5-dimethyl-1-phenylis utilized as a building block in organic synthesis, where it aids in the creation of complex organic molecules and contributes to the advancement of chemical research.
Used in Material Development:
Phospholane, 2,5-dimethyl-1-phenylis also used in the development of new materials, where its unique structure and properties can be leveraged to create innovative and improved materials for various applications.
Used in Biological and Pharmacological Research:
Phospholane, 2,5-dimethyl-1-phenylis employed in research settings to explore its potential biological and pharmacological properties, which may lead to the discovery of new therapeutic agents or applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 40358-68-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,3,5 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40358-68:
(7*4)+(6*0)+(5*3)+(4*5)+(3*8)+(2*6)+(1*8)=107
107 % 10 = 7
So 40358-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H17P/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3
40358-68-7Relevant academic research and scientific papers
Intramolecular hydrophosphination/cyclization of phosphinoalkenes and phosphinoalkynes catalyzed by organolanthanides: Scope, selectivity, and mechanism
Douglass,Stern,Marks
, p. 10221 - 10238 (2007/10/03)
Organolanthanide complexes of the general type Cp′2LnE(TMS)2 (Cp′ = η/5-Me5C5; Ln = La, Sm, Y, Lu; E = CH, N; TMS = SiMe3) serve as effective precatalysts for the rapid intramolecular hydro
