405-68-5 Usage
Uses
Used in Pharmaceutical Industry:
[2-(4-FLUORO-PHENYL)-ETHYL]-METHYL-AMINE is used as a building block or intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, including the fluorine atom, can contribute to the development of new drugs with improved properties, such as increased potency, selectivity, or bioavailability.
Used in Chemical Research:
[2-(4-FLUORO-PHENYL)-ETHYL]-METHYL-AMINE serves as a valuable research compound in the field of organic chemistry. It can be used to study the effects of fluorination on the reactivity and properties of amines, as well as to explore new synthetic pathways and reaction mechanisms.
Used in Material Science:
[2-(4-FLUORO-PHENYL)-ETHYL]-METHYL-AMINE may be employed as a component in the development of new materials with specific properties, such as improved thermal stability, chemical resistance, or electronic characteristics. Its incorporation into polymers or other materials can lead to novel applications in various industries.
Used in Agrochemical Industry:
[2-(4-FLUORO-PHENYL)-ETHYL]-METHYL-AMINE is used as a precursor or active ingredient in the synthesis of agrochemicals, such as pesticides or herbicides. Its unique chemical properties can contribute to the development of more effective and environmentally friendly products for agricultural use.
Used in Dye and Pigment Industry:
[2-(4-FLUORO-PHENYL)-ETHYL]-METHYL-AMINE can be utilized in the production of dyes and pigments, where its fluorinated structure may impart specific color characteristics or improve the stability and performance of the final products. This can be particularly relevant in applications requiring high color fidelity or resistance to environmental factors.
Check Digit Verification of cas no
The CAS Registry Mumber 405-68-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,0 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 405-68:
(5*4)+(4*0)+(3*5)+(2*6)+(1*8)=55
55 % 10 = 5
So 405-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H12FN.ClH/c1-11-7-6-8-2-4-9(10)5-3-8;/h2-5,11H,6-7H2,1H3;1H
405-68-5Relevant academic research and scientific papers
Central nervous system antiischemic agents
-
, (2008/06/13)
A series of phenylalkylaminoalkyl derivatives of Formula I wherein Ar is naphtyl or phenyl; R1 is hydrogen, fluoro or R?CONH-; R2 is hydrogen or C?-? alkyl; R? is C?-? alkyl; R? is C?-? alkyl or phenyl-C?- ? alkyl; x is zero or the integers 1 and 2; m is
