40515-75-1 Usage
Uses
Used in Pharmaceutical Industry:
3-(2-ETHOXYCARBONYL-ETHYL)-5-METHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER is used as a potential therapeutic agent for its anti-inflammatory and anti-cancer properties. Its unique chemical structure allows it to target specific biological pathways and mechanisms involved in inflammation and cancer progression, offering a new approach to the treatment of various diseases.
Used in Drug Synthesis:
3-(2-ETHOXYCARBONYL-ETHYL)-5-METHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER serves as a building block for the synthesis of novel drugs. Its chemical properties and functional groups can be utilized in the development of new pharmaceutical compounds with improved efficacy, selectivity, and reduced side effects. 3-(2-ETHOXYCARBONYL-ETHYL)-5-METHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER can be modified or combined with other chemical entities to create innovative drug candidates for various therapeutic areas.
Further research and development are necessary to fully understand the potential uses and effects of 3-(2-ETHOXYCARBONYL-ETHYL)-5-METHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER. Its exploration in the pharmaceutical industry could lead to the discovery of new treatments for a wide range of diseases, particularly those involving inflammation and cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 40515-75-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,5,1 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 40515-75:
(7*4)+(6*0)+(5*5)+(4*1)+(3*5)+(2*7)+(1*5)=91
91 % 10 = 1
So 40515-75-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO4/c1-4-17-11(15)7-6-10-8-9(3)14-12(10)13(16)18-5-2/h8,14H,4-7H2,1-3H3
40515-75-1Relevant academic research and scientific papers
AN IMPROVED SYNTHESIS OF 2-METHYL-4-(2'-CARBOXYETHYL)PYRROLE. POTENTIAL INHIBITORS OF PORPHOBILINOGEN DEAMINASE
Wilen, Samuel H.,Shen, DeKang,Licata, Joseph M.,Baldwin, Enoch,Russell, Charlotte S.
, p. 1747 - 1757 (2007/10/02)
Improved syntheses of 2-methyl-4-(2'-carboxyethyl)pyrrole (10) (49percent overall yield) and of several O- and S-containing β-(5-ring heterocyclic)-substituted propionic acid are described.Some of these compounds have been found to be inhibitors of porphobilinogen deaminase.
