40775-78-8 Usage
General Description
7-HYDROXY-5-METHYL-2-METHYLTHIO-S-TRIAZOLO[1,5-A]PYRIMIDINE, is a chemical compound with a complex molecular structure. It contains a triazolopyrimidine ring system and a hydroxyl group at the 7th position, as well as a methyl group at the 5th position and a methylthio group at the 2nd position. 7-HYDROXY-5-METHYL-2-METHYLTHIO-S-TRIAZOLO[1,5-A]PYRIMIDINE has potential pharmacological activities due to its unique structure, and it may be used in the development of new drugs for various medical conditions. Additionally, it may have applications in the fields of agriculture or materials science. However, further research is needed to fully understand the properties and potential uses of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 40775-78-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,7 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40775-78:
(7*4)+(6*0)+(5*7)+(4*7)+(3*5)+(2*7)+(1*8)=128
128 % 10 = 8
So 40775-78-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4OS/c1-4-3-5(12)11-6(8-4)9-7(10-11)13-2/h3H,1-2H3,(H,8,9,10)
