40775-78-8 Usage
Uses
Used in Pharmaceutical Industry:
7-HYDROXY-5-METHYL-2-METHYLTHIO-S-TRIAZOLO[1,5-A]PYRIMIDINE is used as a potential drug candidate for the development of new medications due to its unique molecular structure and potential pharmacological activities.
Used in Agricultural Industry:
7-HYDROXY-5-METHYL-2-METHYLTHIO-S-TRIAZOLO[1,5-A]PYRIMIDINE may be used as a component in agricultural products, such as pesticides or fertilizers, due to its potential applications in this field.
Used in Materials Science:
7-HYDROXY-5-METHYL-2-METHYLTHIO-S-TRIAZOLO[1,5-A]PYRIMIDINE could be utilized in the development of new materials, such as polymers or coatings, due to its unique chemical properties.
Note: The specific applications and reasons for using 7-HYDROXY-5-METHYL-2-METHYLTHIO-S-TRIAZOLO[1,5-A]PYRIMIDINE in the pharmaceutical, agricultural, and materials science industries are not explicitly provided in the materials. The uses listed above are based on the potential of the compound's unique structure and the general applications of similar compounds in these industries. Further research is needed to confirm the specific applications and benefits of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 40775-78-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,7 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40775-78:
(7*4)+(6*0)+(5*7)+(4*7)+(3*5)+(2*7)+(1*8)=128
128 % 10 = 8
So 40775-78-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4OS/c1-4-3-5(12)11-6(8-4)9-7(10-11)13-2/h3H,1-2H3,(H,8,9,10)
