40794-04-5 Usage
General Description
5-Chloro-2-methylanisole is a chemical compound known for its chemical formula C8H9ClO. This organic compound characteristically contains chlorine, implying it's a chlorinated aromatic compound. It's commonly utilized in chemical synthesis and reactions as a significant raw material. Since it's not a naturally occurring compound, it is synthesized within laboratory environments for different purposes. However, like other chemicals, it requires secure handling, safety measures and refined storage, as it may pose potential health and environment risks under improper usage. It does not have widespread use and is typically found in specialized industrial or scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 40794-04-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,9 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 40794-04:
(7*4)+(6*0)+(5*7)+(4*9)+(3*4)+(2*0)+(1*4)=115
115 % 10 = 5
So 40794-04-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClO/c1-6-3-4-7(9)5-8(6)10-2/h3-5H,1-2H3
