4080-48-2 Usage
Uses
As the provided materials do not specify the uses or applications of 2-Pyridinecarboxylic acid, 6-ethyl-(9CI), it is not possible to list its uses based on the given information. However, as a derivative of pyridine, it may potentially be used in various industries, such as pharmaceuticals, agrochemicals, or materials science, depending on its properties and reactivity. Further research and experimentation would be required to determine its specific applications and benefits in these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4080-48-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,8 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4080-48:
(6*4)+(5*0)+(4*8)+(3*0)+(2*4)+(1*8)=72
72 % 10 = 2
So 4080-48-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c1-2-6-4-3-5-7(9-6)8(10)11/h3-5H,2H2,1H3,(H,10,11)