40843-28-5 Usage
Description
Propanoic acid, 2-[4-(4-methylphenoxy)phenoxy]is a carboxylic acid derivative characterized by the presence of two phenoxy groups attached to the second carbon and a methyl group on one of the phenoxy groups. This unique structure endows it with versatile properties, making it a valuable compound in various industrial applications.
Uses
Used in Chemical Production:
Propanoic acid, 2-[4-(4-methylphenoxy)phenoxy]is utilized as a key intermediate in the synthesis of various industrial chemicals. Its unique structural properties allow it to serve as a building block for the development of new compounds with specific functionalities.
Used in Pharmaceutical Synthesis:
Propanoic acid, 2-[4-(4-methylphenoxy)phenoxy]is employed as a precursor in the production of pharmaceuticals. Its ability to form stable bonds with other molecules makes it a promising candidate for the development of new drugs with improved therapeutic properties.
Used in Agrochemical Synthesis:
Propanoic acid, 2-[4-(4-methylphenoxy)phenoxy]is also used in the synthesis of agrochemicals, contributing to the development of more effective and environmentally friendly pesticides and fertilizers.
Used in Plasticizer Manufacturing:
As a precursor, this compound is involved in the production of plasticizers, which are additives used to increase the flexibility and workability of plastics. Its unique structure allows for the creation of plasticizers with specific properties tailored to various applications.
Used in Dye Production:
Propanoic acid, 2-[4-(4-methylphenoxy)phenoxy]is utilized in the synthesis of dyes, where its structural properties contribute to the development of dyes with improved colorfastness and stability.
Used in Material Science and Polymer Chemistry:
Due to its unique structural properties, this compound has potential applications in the field of material science and polymer chemistry. It can be used to develop new materials with specific properties, such as improved mechanical strength, thermal stability, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 40843-28-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,8,4 and 3 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40843-28:
(7*4)+(6*0)+(5*8)+(4*4)+(3*3)+(2*2)+(1*8)=105
105 % 10 = 5
So 40843-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H16O4/c1-11-3-5-14(6-4-11)20-15-9-7-13(8-10-15)19-12(2)16(17)18/h3-10,12H,1-2H3,(H,17,18)
