40870-62-0 Usage
Uses
Used in Chemical Synthesis:
2,5-Dimethoxy-3,4-dimethylbenzenemethanol acetate is used as a solvent for facilitating various chemical reactions, enhancing the efficiency and yield of the processes. Its solubility properties make it an ideal medium for dissolving reactants and promoting their interaction.
Used in Pharmaceutical Production:
2,5-Dimethoxy-3,4-dimethylbenzenemethanol acetate is used as an intermediate in the production of pharmaceuticals, contributing to the synthesis of active ingredients and other medicinal compounds. Its chemical structure plays a crucial role in the formation of these pharmaceuticals, making it an essential component in the industry.
Used in Flavoring and Fragrance Industry:
2,5-Dimethoxy-3,4-dimethylbenzenemethanol acetate is used as a flavoring and fragrance agent in the food and beverage industry, adding unique scents and tastes to products. Its aromatic properties make it a popular choice for enhancing the sensory experience of consumers.
Used in Safety and Handling:
2,5-Dimethoxy-3,4-dimethylbenzenemethanol acetate is used with caution in various industries due to its potential hazards. Proper handling and safety measures are essential to prevent adverse effects on health and the environment, ensuring that its benefits are realized without compromising safety standards.
Check Digit Verification of cas no
The CAS Registry Mumber 40870-62-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,8,7 and 0 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40870-62:
(7*4)+(6*0)+(5*8)+(4*7)+(3*0)+(2*6)+(1*2)=110
110 % 10 = 0
So 40870-62-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O4/c1-8-9(2)13(16-5)11(6-12(8)15-4)7-17-10(3)14/h6H,7H2,1-5H3
