412027-25-9 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE-4-CARBOXYLATE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, ETHYL 2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE-4-CARBOXYLATE serves as a valuable compound for studying the properties and reactions of benzazepine derivatives. This can lead to a better understanding of their chemical behavior and potential applications in various industries.
Used in Material Science:
ETHYL 2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE-4-CARBOXYLATE is used as a component in the development of new materials with specific properties. Its incorporation into materials can alter their physical and chemical characteristics, making them suitable for various applications, such as in electronics or as specialty coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 412027-25-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,2,0,2 and 7 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 412027-25:
(8*4)+(7*1)+(6*2)+(5*0)+(4*2)+(3*7)+(2*2)+(1*5)=89
89 % 10 = 9
So 412027-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO3/c1-2-17-13(16)10-7-9-5-3-4-6-11(9)14-12(15)8-10/h3-6,10H,2,7-8H2,1H3,(H,14,15)