41266-71-1 Usage
Uses
Used in Pharmaceutical Industry:
(5,7-DIMETHYL-[1,2,4]TRIAZOLO[4,3-A]PYRIMIDIN-3-YLSULFANYL)-ACETIC ACID is used as a potential therapeutic agent for its bioactivity in cancer treatment. Its unique structure allows it to target specific biological pathways and mechanisms involved in cancer progression, offering a new avenue for the development of anticancer drugs.
Additionally, in Antiviral Research:
(5,7-DIMETHYL-[1,2,4]TRIAZOLO[4,3-A]PYRIMIDIN-3-YLSULFANYL)-ACETIC ACID is utilized as a candidate for antiviral drug development due to its potential to interfere with viral replication and infection processes. Its sulfanyl group may contribute to its antiviral properties, making it a subject of interest for further research and development in combating viral diseases.
In Drug Development:
(5,7-DIMETHYL-[1,2,4]TRIAZOLO[4,3-A]PYRIMIDIN-3-YLSULFANYL)-ACETIC ACID is employed as a lead compound in the discovery and optimization of new pharmaceuticals. Its triazolopyrimidine core and sulfanyl functionality provide a foundation for the design of novel drugs with improved efficacy, selectivity, and safety profiles for various therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 41266-71-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,2,6 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 41266-71:
(7*4)+(6*1)+(5*2)+(4*6)+(3*6)+(2*7)+(1*1)=101
101 % 10 = 1
So 41266-71-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4O2S/c1-5-3-6(2)13-8(10-5)11-12-9(13)16-4-7(14)15/h3H,4H2,1-2H3,(H,14,15)/p-1
