41622-04-2 Usage
Uses
Used in Pharmaceutical Industry:
N-[5-[bis(2-methoxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)azo]phenyl]acetamide is used as a pharmaceutical compound for its potential therapeutic properties. Its complex structure and multiple functional groups may allow it to interact with biological targets, offering opportunities for the development of new drugs.
Used in Dyes Industry:
In the dyes industry, N-[5-[bis(2-methoxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)azo]phenyl]acetamide is used as a colorant due to its azo group, which is known for imparting a range of colors to various materials. Its unique structure may provide novel color characteristics and properties for use in textiles, plastics, and other applications.
Used in Organic Synthesis:
N-[5-[bis(2-methoxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)azo]phenyl]acetamide is utilized as an intermediate in organic synthesis for the production of other complex organic compounds. Its versatile functional groups can be modified or used as building blocks to create new molecules with specific properties and applications.
Given the complex structure of N-[5-[bis(2-methoxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)azo]phenyl]acetamide, it would require thorough testing and analysis to determine its specific uses and properties fully. Its potential applications in pharmaceuticals, dyes, and organic synthesis highlight the importance of exploring and understanding such compounds for their possible contributions to various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 41622-04-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,6,2 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 41622-04:
(7*4)+(6*1)+(5*6)+(4*2)+(3*2)+(2*0)+(1*4)=82
82 % 10 = 2
So 41622-04-2 is a valid CAS Registry Number.
InChI:InChI=1/C21H23BrN6O5/c1-14(29)24-20-12-16(27(6-8-32-2)7-9-33-3)4-5-19(20)25-26-21-15(13-23)10-17(28(30)31)11-18(21)22/h4-5,10-12H,6-9H2,1-3H3,(H,24,29)/b26-25+
41622-04-2Relevant articles and documents
Novel compound crystal form and preparing method and application thereof
-
Paragraph 0027; 0028; 0029; 0030; 0031, (2016/11/24)
The invention discloses a disperse dye compound H-form crystal as shown in the formula (1) and a preparing method and application thereof.The X-ray powder diffraction pattern has diffraction peaks when the diffraction angles 2 theta are 10.92, 17.56, 18.77, 20.17, 21.61, 23.31, 24.04, 26.08, 26.55 and 29.36.