41636-35-5 Usage
Uses
Used in Polymer Science:
2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE RUTHENIUM(II) CARBONYL is used as a component in the formation of blended polymeric films for enhancing the properties of the resulting materials. The expression is: RuOEP is used as a component in the formation of blended polymeric films with poly(3-hexythiopene-2,5-diyl) (P3HT) to improve the film's characteristics, such as conductivity, stability, and processability.
In the field of polymer science, RuOEP can be utilized to create novel materials with enhanced properties by blending it with other polymers like P3HT. The resulting films can find applications in various industries, such as electronics, where improved conductivity and stability are desired.
Check Digit Verification of cas no
The CAS Registry Mumber 41636-35-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,6,3 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 41636-35:
(7*4)+(6*1)+(5*6)+(4*3)+(3*6)+(2*3)+(1*5)=105
105 % 10 = 5
So 41636-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C36H44N4.CO.Ru/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;1-2;/h17-20H,9-16H2,1-8H3;;/q-2;;+2/b29-17-,30-18u,31-17u,32-18-,33-19u,34-20u,35-19u,36-20u;;