41812-62-8 Usage
Uses
Used in Pharmaceutical Industry:
N-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)guanidine is used as a lead compound for the development of new antimicrobial agents due to its demonstrated effectiveness against various microorganisms, including bacteria and fungi. Its ability to target and inhibit the growth of these pathogens makes it a valuable asset in the fight against antibiotic-resistant infections.
Used in Antiviral Applications:
In the field of antiviral research, N-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)guanidine is utilized as a potential therapeutic agent for the treatment of viral infections. Its antiviral properties have been studied, and it has shown promise in inhibiting the replication and spread of certain viruses, offering a potential alternative or adjunct to existing antiviral medications.
Used in Antiparasitic Applications:
N-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)guanidine is also considered for use as an antiparasitic agent, targeting the elimination or control of parasitic infections. Its potential to disrupt the life cycle or vital processes of parasites positions it as a candidate for the development of new treatments for parasitic diseases.
Used in Drug Development Research:
Due to its versatile chemical structure and demonstrated biological activities, N-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)guanidine is used as a starting point for the synthesis of novel compounds with improved pharmacological properties. Researchers in drug development are exploring its potential for the creation of new drugs with enhanced efficacy, selectivity, and reduced side effects for various therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 41812-62-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,8,1 and 2 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 41812-62:
(7*4)+(6*1)+(5*8)+(4*1)+(3*2)+(2*6)+(1*2)=98
98 % 10 = 8
So 41812-62-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N4OS/c5-3(6)8-4-7-2(9)1-10-4/h1H2,(H4,5,6,7,8,9)
