41960-47-8 Usage
Description
2-Cyano-5-iodopyridine is a pyridine derivative with the molecular formula C6H3IN2, featuring a cyano group and an iodine atom attached to the 2 and 5 positions of the pyridine ring, respectively. This chemical compound serves as a versatile building block in various fields due to its unique structural properties.
Uses
Used in Organic Synthesis:
2-Cyano-5-iodopyridine is used as a versatile building block for the preparation of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure allows for the synthesis of a wide range of compounds with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Cyano-5-iodopyridine is used as a key intermediate in the synthesis of biologically active molecules. Its presence in the molecular structure can contribute to the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
2-Cyano-5-iodopyridine is employed as a reagent in the production of heterocyclic compounds, which are often found in agrochemicals. These heterocyclic compounds can be used as pesticides, herbicides, or other agricultural chemicals to protect crops and enhance agricultural productivity.
Used in Material Science:
2-Cyano-5-iodopyridine has been studied for its potential applications in material science. Its unique structural properties may contribute to the development of new materials with specific properties, such as conductivity, magnetism, or optical characteristics.
Used in Medicinal Chemistry:
In medicinal chemistry, 2-Cyano-5-iodopyridine is used as a precursor in the synthesis of biologically active molecules. Its presence in the molecular structure can enhance the pharmacological properties of the resulting compounds, leading to the development of more effective drugs for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 41960-47-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,9,6 and 0 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 41960-47:
(7*4)+(6*1)+(5*9)+(4*6)+(3*0)+(2*4)+(1*7)=118
118 % 10 = 8
So 41960-47-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H3IN2/c7-5-1-2-6(3-8)9-4-5/h1-2,4H
41960-47-8Relevant articles and documents
DERIVATIVES OF 6,7-DIHYDRO-5H-IMIDAZO[1,2-α]IMIDAZOLE-3- CARBOXYLIC ACID AMIDES
-
Page/Page column 112-113, (2009/07/03)
Derivatives of 6,7-dihydro-5H-imidazo[1,2-α]imidazole-3-carboxylic acid amide exhibit good inhibitory effect upon the interaction of CAMs and Leukointegrins and are thus useful in the treatment of inflammatory disease.
