42135-38-6 Usage
Uses
Used in Organic Chemistry:
9-OXO-9H-FLUORENE-4-CARBOXAMIDE is used as a key intermediate in the synthesis of complex organic molecules. Its presence in the molecular structure allows for the creation of new compounds with diverse applications across various fields.
Used in Materials Science:
In the field of materials science, 9-OXO-9H-FLUORENE-4-CARBOXAMIDE is utilized as a precursor for developing novel materials. Its unique structure contributes to the formation of materials with enhanced properties, such as improved stability, reactivity, or specific interactions with other molecules.
Used in Pharmaceutical Industry:
9-OXO-9H-FLUORENE-4-CARBOXAMIDE is used as a potential pharmaceutical agent for the development of new drugs. Its structural features may facilitate the design of molecules with specific therapeutic effects, targeting various diseases and medical conditions.
Used in Research and Development:
9-OXO-9H-FLUORENE-4-CARBOXAMIDE serves as a subject of research and development in both academia and industry. Its exploration can lead to the discovery of new materials with advanced properties, opening up new avenues for applications in various industries, including electronics, coatings, and more.
Check Digit Verification of cas no
The CAS Registry Mumber 42135-38-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,1,3 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 42135-38:
(7*4)+(6*2)+(5*1)+(4*3)+(3*5)+(2*3)+(1*8)=86
86 % 10 = 6
So 42135-38-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H9NO2/c15-14(17)11-7-3-6-10-12(11)8-4-1-2-5-9(8)13(10)16/h1-7H,(H2,15,17)
