42949-24-6 Usage
Uses
Used in Organic Synthesis:
5-Azaadamantan-2-one is utilized as a building block in the synthesis of various organic compounds. Its unique structure and reactivity make it a versatile precursor in chemical reactions, contributing to the creation of a wide array of organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-Azaadamantan-2-one serves as a valuable compound for the development of pharmaceuticals. The presence of the nitrogen atom in its ring structure allows for functionalization and modification, enhancing its potential as a precursor in the synthesis of novel therapeutic agents.
Used in Pharmaceutical Development:
5-Azaadamantan-2-one is employed as a key intermediate in the design and synthesis of new pharmaceuticals. Its unique structural features and reactivity provide opportunities for the development of innovative drugs with improved efficacy and selectivity.
Used in Chemical Research:
5-Azaadamantan-2-one is also used in chemical research to explore new reaction pathways and mechanisms. Its unique properties make it an interesting subject for studying the effects of nitrogen substitution in cyclic structures and their implications in chemical behavior.
Used in Drug Design and Discovery:
5-Azaadamantan-2-one plays a role in drug design and discovery, where its structural attributes can be leveraged to create molecules with specific biological activities. Its adaptability in chemical reactions facilitates the development of targeted therapeutic agents for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 42949-24-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,9,4 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 42949-24:
(7*4)+(6*2)+(5*9)+(4*4)+(3*9)+(2*2)+(1*4)=136
136 % 10 = 6
So 42949-24-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO/c11-9-7-1-6-2-8(9)5-10(3-6)4-7/h6-8H,1-5H2
42949-24-6Relevant academic research and scientific papers
MULTICYCLIC TERTIARY AMINE POLYAROMATIC SQUALENE SYNTHASE INHIBITORS
-
, (2008/06/13)
This invention relates to polycyclic compounds containing two mono- and/or bicyclic rings and a basic tertiary amino group capable of forming an ammonium ion at biological pH and which reduces levels of serum cholesterol in the body without significantly reducing mevalonic metabolite synthesis. This invention relates also to pharmacological compositions and method of treatment for lowering serum cholesterol levels using the compounds of this invention. The compounds of this invention are described by the formula where Ar I is phenylene or naphthylene, Ar II is phenyl or naphthyl and A is 1-azabicyclo[2.2.2]octan-3-yl
