4330-22-7 Usage
Description
2,4-Dimethoxy-5-fluoropyrimidine is a specialized chemical compound that belongs to the Pyrimidines class, which are heterocyclic aromatic compounds similar to pyridine. It is characterized by the presence of methoxy and fluorine substituents in its molecular structure. 2,4-DIMETHOXY-5-FLUOROPYRIMIDINE is typically used in chemistry labs for a variety of applications and is often associated with synthetic chemistry reactions, particularly in the area of drug synthesis and pharmaceutical chemistry. Due to the potential health effects, chemical stability, and environmental impacts, proper care and handling are encouraged when using this compound.
Uses
Used in Pharmaceutical Chemistry:
2,4-Dimethoxy-5-fluoropyrimidine is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique molecular structure with methoxy and fluorine substituents makes it a valuable building block for the development of new drugs.
Used in Synthetic Chemistry:
2,4-Dimethoxy-5-fluoropyrimidine is used as a reactant in synthetic chemistry reactions. Its presence in the molecular structure allows for the creation of a wide range of chemical products, contributing to the advancement of chemical research and development.
Used in Chemistry Labs:
2,4-Dimethoxy-5-fluoropyrimidine is used as a research compound in chemistry labs. Its properties and reactivity are studied to better understand its potential applications and to develop new methods for its synthesis and use in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 4330-22-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,3 and 0 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4330-22:
(6*4)+(5*3)+(4*3)+(3*0)+(2*2)+(1*2)=57
57 % 10 = 7
So 4330-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7FN2O2/c1-10-5-4(7)3-8-6(9-5)11-2/h3H,1-2H3
4330-22-7Relevant articles and documents
Method for preparing 2,4-dichloro-5-fluoropyrimidine through ultraviolet photocatalytic reaction
-
Paragraph 0012, (2019/06/12)
The invention relates to a method for preparing 2,4-dichloro-5-fluoropyrimidine through an ultraviolet photocatalytic reaction. The problem of environmental pollution caused by preparation and waste acid treatment of 2,4-dichloro-5-fluoropyrimidine can be effectively solved. The method comprises the steps that 2,4-dimethoxy-5-fluoropyrimidine is dissolved in a solvent the weight volume of which is10-20 times that of the 2,4-dimethoxy-5-fluoropyrimidine, wherein according to the weight volume, the unit of solids is gram, and the unit of liquid is milliliter; a catalyst sulfuryl chloride is added, and the addition amount of the catalyst sulfuryl chloride is 2-5% of the mass of the 2,4-dichloro-5-fluoropyrimidine; after ultraviolet light irradiation is conducted for 10 minutes, chlorine gasis introduced, the reaction temperature is 15-30 DEG C, and stirring while chlorine introduction is conducted for 12 hours; an equal volume of ice water is added, liquid separation is conducted, an organic phase is washed with an aqueous sodium carbonate solution with the mass concentration of 5%, and water washing, drying and concentration under reduced pressure are conducted to form the solid product 2,4-dichloro-5-fluoropyrimidine. The preparation method is simple, easy to operate, low in cost and free of waste residues, effectively prevents environmental pollution and has significant economic and social benefits.