4353-01-9 Usage
Uses
Used in Antimicrobial Applications:
4-methyl-2-styryl-1,3-dioxolane is used as an antimicrobial agent due to its ability to exhibit antimicrobial activity. This makes it a potential candidate for use in various industries where microbial control is necessary.
Used in Flavor and Fragrance Industry:
4-methyl-2-styryl-1,3-dioxolane is used as a flavoring agent and fragrance ingredient in the food and cosmetics industries. Its unique chemical structure contributes to its distinct aroma and taste, making it a valuable addition to these products.
Used in Pharmaceutical Industry:
4-methyl-2-styryl-1,3-dioxolane is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical properties make it a versatile building block for the development of new drugs and medications.
Used in Chemical Research:
4-methyl-2-styryl-1,3-dioxolane is used as a research compound in various scientific studies. Its unique structure and properties make it an interesting subject for investigation, potentially leading to new discoveries and applications in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 4353-01-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,5 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4353-01:
(6*4)+(5*3)+(4*5)+(3*3)+(2*0)+(1*1)=69
69 % 10 = 9
So 4353-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O2/c1-10-9-13-12(14-10)8-7-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3/b8-7+
4353-01-9Relevant academic research and scientific papers
Investigation of the Effectiveness of Various 1-Dialkylamino-1-methoxycarbenium-Methyl Sulfates in the Course of Acetalization
Kantlehner, Willi,Gutbrod, Heinz-Dieter,Funke, Bernd
, p. 246 - 252 (2007/10/02)
The rate of dimethyl ketal formation from acetone and methanol in the presence of several 1-dialkylamino-1-methoxycarbenium methyl sulfates 1a, 5a-g is studied.The fastest rate was observed in the case of 5c.In the presence of 5c, the reaction of carbonyl compounds with either methanol or 1,2-diols gave the dimethyl ketals 6 and 1,3-dioxolanes 7, respectively.