4354-56-7 Usage
Description
6-Cyclohexylhexanoic Acid, with the chemical formula C12H22O2 and CAS number 4354-56-7, is an organic compound characterized by a cyclohexane ring and a hexanoic acid chain. It is a white crystalline solid that is soluble in organic solvents and has a molecular weight of approximately 202.31 g/mol. 6-CYCLOHEXYL-HEXANOIC ACID is known for its potential applications in the pharmaceutical and chemical industries due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
6-Cyclohexylhexanoic Acid is used as a key intermediate in the synthesis of N-Acylethanolamine Acid Amidase (NAAA) inhibitors. These inhibitors are of significant interest due to their anti-inflammatory and analgesic activities, making them valuable for the development of new drugs to treat pain and inflammation-related disorders.
In the synthesis process, 6-Cyclohexylhexanoic Acid serves as a building block for the formation of NAAA inhibitors, contributing to the overall structure and activity of the final product. Its cyclohexane ring and hexanoic acid chain provide a unique combination of lipophilicity and hydrogen bonding capabilities, which are essential for the interaction with the target enzyme and the subsequent biological effects.
Furthermore, the development of NAAA inhibitors using 6-Cyclohexylhexanoic Acid as a starting material offers an opportunity to explore novel therapeutic approaches for various inflammatory and pain conditions. By targeting the NAAA enzyme, these inhibitors can modulate the levels of bioactive lipid mediators, such as anandamide, which play a crucial role in the regulation of pain and inflammation.
Check Digit Verification of cas no
The CAS Registry Mumber 4354-56-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,5 and 4 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4354-56:
(6*4)+(5*3)+(4*5)+(3*4)+(2*5)+(1*6)=87
87 % 10 = 7
So 4354-56-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H22O2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h11H,1-10H2,(H,13,14)
4354-56-7Relevant articles and documents
Nickel-butadiene catalytic system for the cross-coupling of bromoalkanoic acids with alkyl grignard reagents: A practical and versatile method for preparing fatty acids
Iwasaki, Takanori,Higashikawa, Kiyokazu,Reddy, Vutukuri P.,Ho, Willbe W. S.,Fujimoto, Yukari,Fukase, Koichi,Terao, Jun,Kuniyasu, Hitoshi,Kambe, Nobuaki
supporting information, p. 2956 - 2960 (2013/03/28)
The knights who say Ni: A practical and convenient synthetic route to fatty acids involves the Ni-catalyzed alkyl-alkyl cross-coupling of bromoalkanoic acids and alkyl Grignard reagents in the presence of 1,3-butadiene as an additive (see scheme). Copyright