4445-09-4 Usage
Uses
Used in Organic Synthesis:
1-Stearylboronic acid is used as a reagent for the formation of carbon-carbon and carbon-heteroatom bonds, which are crucial in constructing complex organic molecules.
Used in Pharmaceutical Development:
1-Stearylboronic acid is utilized in the development of new pharmaceuticals and agrochemicals due to its selective binding capabilities to specific biological targets, which can lead to the creation of more targeted and effective treatments.
Used in Materials Science:
In the field of materials science, 1-stearylboronic acid is employed for the synthesis of functionalized polymers and advanced materials, contributing to the development of innovative materials with specialized properties.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
1-Stearylboronic acid is particularly used as a reagent in Suzuki-Miyaura cross-coupling reactions, which are significant in the formation of biaryl compounds, a class of compounds that are prevalent in pharmaceuticals, agrochemicals, and materials with unique electronic and optical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 4445-09-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,4 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4445-09:
(6*4)+(5*4)+(4*4)+(3*5)+(2*0)+(1*9)=84
84 % 10 = 4
So 4445-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H39BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h20-21H,2-18H2,1H3
