4445-51-6 Usage
Uses
Used in Pharmaceutical Industry:
2,5-DIPHENYLDICARBONIC ACID is used as a building block for the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its reactivity allows for the creation of diverse chemical structures, which can be tailored for specific medicinal applications.
Used in Dye Industry:
In the dye industry, 2,5-DIPHENYLDICARBONIC ACID is utilized as a precursor in the production of various dyes. Its chemical properties enable the synthesis of dyes with unique color characteristics and stability, catering to different industrial needs.
Used in Polymer Production:
2,5-DIPHENYLDICARBONIC ACID is used as a monomer in the production of polymers. Its incorporation into polymer chains can enhance properties such as strength, flexibility, and durability, making the resulting polymers suitable for a wide range of applications.
Used as a Reagent in Organic Reactions:
In organic chemistry, 2,5-DIPHENYLDICARBONIC ACID serves as a reagent, facilitating various chemical reactions. Its reactivity allows for the formation of new compounds and the modification of existing ones, broadening the scope of organic synthesis.
Used in Materials Science:
2,5-DIPHENYLDICARBONIC ACID is employed in materials science for the development of new materials with specific properties. Its versatile nature allows for the creation of materials with tailored characteristics, such as improved conductivity, strength, or thermal stability, for use in various applications.
Used in Agriculture:
In agriculture, 2,5-DIPHENYLDICARBONIC ACID may be used in the synthesis of agrochemicals, such as pesticides or fertilizers. Its potential applications in this field can contribute to the development of more effective and environmentally friendly agricultural products.
Check Digit Verification of cas no
The CAS Registry Mumber 4445-51-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,4 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4445-51:
(6*4)+(5*4)+(4*4)+(3*5)+(2*5)+(1*1)=86
86 % 10 = 6
So 4445-51-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H10O4/c15-13(16)10-6-7-11(14(17)18)12(8-10)9-4-2-1-3-5-9/h1-8H,(H,15,16)(H,17,18)
4445-51-6Relevant academic research and scientific papers
Liquid-phase catalytic oxidation of 2,5-dimethylbiphenyl
Koshel',Magagnini,Koshel',Lebedeva,Postnova,Kulichikhin,Bilibin
, p. 830 - 833 (2007/10/03)
Liquid-phase catalytic oxidation of 2,5-dimethylbiphenyl provided 2,5-biphenyldicarboxylic acid. The effect on reaction of temperature, catalyst type, and reagents concentration was investigated.