45597-00-0 Usage
Uses
Used in Pharmaceutical Industry:
(3R,5S)-3,5-diMethylMorpholine is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form stable and bioactive compounds. Its chiral nature allows for the creation of enantiomer-specific drugs, which can have different therapeutic effects and reduce potential side effects.
Used in Agrochemical Industry:
In the agrochemical sector, (3R,5S)-3,5-diMethylMorpholine is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its unique structure contributes to the development of effective and targeted agrochemicals with reduced environmental impact.
Used in Organic Synthesis:
(3R,5S)-3,5-diMethylMorpholine serves as a versatile building block in organic synthesis, enabling the creation of a diverse range of organic compounds with specific properties. Its reactivity and structural features make it suitable for the synthesis of complex molecules and the modification of existing compounds to enhance their performance.
Used in Chemical Research:
In the field of chemical research, (3R,5S)-3,5-diMethylMorpholine is employed as a model compound to study the properties and reactions of chiral molecules. Its unique structure provides insights into the behavior of enantiomers and their interactions with other molecules, contributing to the advancement of stereochemistry and asymmetric synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 45597-00-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,5,5,9 and 7 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 45597-00:
(7*4)+(6*5)+(5*5)+(4*9)+(3*7)+(2*0)+(1*0)=140
140 % 10 = 0
So 45597-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO/c1-5-3-8-4-6(2)7-5/h5-7H,3-4H2,1-2H3/t5-,6+
45597-00-0Relevant academic research and scientific papers
Quinoxaline compounds
-
Page/Page column 23, (2008/06/13)
Certain amidophenyl-sulfonylamino-quinoxaline compounds are CCK2 modulators useful in the treatment of CCK2 mediated diseases.
Alicyclic Nitrosamines and Nitrosamino Acids as Transnitrosating Agents
Singer, Sandra S.,Singer, George M.,Cole, Barbara B.
, p. 4931 - 4935 (2007/10/02)
Many alicyclic nitrosamines act as nitrosating agents under mild conditions (pH 1-3, in the presence of nucleophilic catalysts such as thiocyanate).All nitrosopiperazines, nitrosomorpholines, and nitrosamino acids tested were found to act as nitrosating agents, and certain nitrosopiperidines also showed this capability.Acyclic nitrosamines are far less reactive than functionally similar cyclic compounds.
