46026-75-9 Usage
Uses
Used in Pharmaceutical Industry:
2,5-DIBROMOPIPERIDINE is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block for the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
2,5-DIBROMOPIPERIDINE is utilized as a research compound in various chemical studies. Its properties and reactivity can provide insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Used in Material Science:
2,5-DIBROMOPIPERIDINE can be employed in the development of new materials with specific properties. Its unique structure and reactivity can be harnessed to create materials with tailored characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 46026-75-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,6,0,2 and 6 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 46026-75:
(7*4)+(6*6)+(5*0)+(4*2)+(3*6)+(2*7)+(1*5)=109
109 % 10 = 9
So 46026-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5+/m1/s1
46026-75-9Relevant academic research and scientific papers
Synthesis of (2S*,4R*,5S*)-piperidinetricarboxylic acid, a non-proteinogenic amino acid isolated from clitocybe acromelalga
Hashimoto, Kimiko,Higashibayashi, Shuhei,Shirahama, Haruhisa
, p. 581 - 588 (2007/10/03)
(255*,4R*,5S*)-Piperidinetricarboxylic acid isolated from a poisonous mushroom Clitocybe acromelalga was synthesized along with its stereoisomers and their depolarizing activity was tested.
HETEROCYCLIC-NMDA ANTAGONISTS
-
, (2008/06/13)
The present invention is directed to a class of 3-phosphono-piperidine and pyrrolidine derivatives and their use as NMDA antagonists.
